C19H26BrN3 — CID 143441934
(5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-N-ethyl-5,6-dimethyl-4-methylidenedeca-2,5,7,9-tetraen-1-amine (PubChem CID 143441934) has the molecular formula C19H26BrN3 and a molecular weight of 376.34 g/mol. Its IUPAC name is (5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-N-ethyl-5,6-dimethyl-4-methylidenedeca-2,5,7,9-tetraen-1-amine.
| Compound Name | (5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-N-ethyl-5,6-dimethyl-4-methylidenedeca-2,5,7,9-tetraen-1-amine |
|---|---|
| PubChem CID | 143441934 |
| Molecular Formula | C19H26BrN3 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-N-ethyl-5,6-dimethyl-4-methylidenedeca-2,5,7,9-tetraen-1-amine |
| SMILES | C=C/C=C\C(C)=C(/C)C(=C)C=CC(NCC)n1ncc(Br)c1C |
| InChI | InChI=1S/C19H26BrN3/c1-7-9-10-14(3)16(5)15(4)11-12-19(21-8-2)23-17(6)18(20)13-22-23/h7,9-13,19,21H,1,4,8H2,2-3,5-6H3/b10-9-,12-11?,16-14+ |
| InChIKey | JXFGQGRSSXVWPA-VWXZIYRWSA-N |
| XLogP | 5.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|