C22H28ClF4N3O2 — CID 143443359
acetylene;3-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]propan-1-one (PubChem CID 143443359) has the molecular formula C22H28ClF4N3O2 and a molecular weight of 477.93 g/mol. Its IUPAC name is acetylene;3-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]propan-1-one.
| Compound Name | acetylene;3-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 143443359 |
| Molecular Formula | C22H28ClF4N3O2 |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | acetylene;3-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-[(4-fluorophenyl)methyl]-4-hydroxypiperidin-1-yl]propan-1-one |
| SMILES | C#C.CCN(CCC(=O)N1CCC(O)(Cc2ccc(F)cc2)CC1)/N=C(\CCl)C(F)(F)F |
| InChI | InChI=1S/C20H26ClF4N3O2.C2H2/c1-2-28(26-17(14-21)20(23,24)25)10-7-18(29)27-11-8-19(30,9-12-27)13-15-3-5-16(22)6-4-15;1-2/h3-6,30H,2,7-14H2,1H3;1-2H/b26-17+; |
| InChIKey | DBALQCFRAXZSTM-VOGLITBBSA-N |
| XLogP | 3.84 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|