C17H20ClF5N4O — CID 143061787
2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-(3,4-difluorophenyl)piperazin-1-yl]ethanone (PubChem CID 143061787) has the molecular formula C17H20ClF5N4O and a molecular weight of 426.82 g/mol. Its IUPAC name is 2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-(3,4-difluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-(3,4-difluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143061787 |
| Molecular Formula | C17H20ClF5N4O |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]-1-[4-(3,4-difluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CCN(CC(=O)N1CCN(c2ccc(F)c(F)c2)CC1)/N=C(\CCl)C(F)(F)F |
| InChI | InChI=1S/C17H20ClF5N4O/c1-2-27(24-15(10-18)17(21,22)23)11-16(28)26-7-5-25(6-8-26)12-3-4-13(19)14(20)9-12/h3-4,9H,2,5-8,10-11H2,1H3/b24-15+ |
| InChIKey | CSXUCQVBDBGDCK-BUVRLJJBSA-N |
| XLogP | 3.09 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|