C25H36Cl2F3N5O4 — CID 143061823
1-[4-[4-chloro-2-(morpholine-4-carbonyl)phenyl]-1,4-diazepan-1-yl]-2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]ethanone;methoxymethane (PubChem CID 143061823) has the molecular formula C25H36Cl2F3N5O4 and a molecular weight of 598.49 g/mol. Its IUPAC name is 1-[4-[4-chloro-2-(morpholine-4-carbonyl)phenyl]-1,4-diazepan-1-yl]-2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]ethanone;methoxymethane.
| Compound Name | 1-[4-[4-chloro-2-(morpholine-4-carbonyl)phenyl]-1,4-diazepan-1-yl]-2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]ethanone;methoxymethane |
|---|---|
| PubChem CID | 143061823 |
| Molecular Formula | C25H36Cl2F3N5O4 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 1-[4-[4-chloro-2-(morpholine-4-carbonyl)phenyl]-1,4-diazepan-1-yl]-2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]ethanone;methoxymethane |
| SMILES | CCN(CC(=O)N1CCCN(c2ccc(Cl)cc2C(=O)N2CCOCC2)CC1)/N=C(\CCl)C(F)(F)F.COC |
| InChI | InChI=1S/C23H30Cl2F3N5O3.C2H6O/c1-2-33(29-20(15-24)23(26,27)28)16-21(34)31-7-3-6-30(8-9-31)19-5-4-17(25)14-18(19)22(35)32-10-12-36-13-11-32;1-3-2/h4-5,14H,2-3,6-13,15-16H2,1H3;1-2H3/b29-20+; |
| InChIKey | BHOUZQBWOJHVJD-PXNGTKLSSA-N |
| XLogP | 3.59 |
| TPSA | 77.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|