C17H23ClF3N5O2 — CID 143061825
N'-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylamino]-2,2,2-trifluoroethanimidamide (PubChem CID 143061825) has the molecular formula C17H23ClF3N5O2 and a molecular weight of 421.85 g/mol. Its IUPAC name is N'-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylamino]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylamino]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 143061825 |
| Molecular Formula | C17H23ClF3N5O2 |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N'-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylamino]-2,2,2-trifluoroethanimidamide |
| SMILES | CCN(CC(=O)N1CCN(c2ccc(Cl)c(OC)c2)CC1)/N=C(\N)C(F)(F)F |
| InChI | InChI=1S/C17H23ClF3N5O2/c1-3-26(23-16(22)17(19,20)21)11-15(27)25-8-6-24(7-9-25)12-4-5-13(18)14(10-12)28-2/h4-5,10H,3,6-9,11H2,1-2H3,(H2,22,23) |
| InChIKey | ZHCYGHHCOASNGM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|