C19H25Cl2F3N4O2 — CID 143061332
1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-[[(Z)-(1-chloro-4,4,4-trifluorobutan-2-ylidene)amino]-ethylamino]ethanone (PubChem CID 143061332) has the molecular formula C19H25Cl2F3N4O2 and a molecular weight of 469.34 g/mol. Its IUPAC name is 1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-[[(Z)-(1-chloro-4,4,4-trifluorobutan-2-ylidene)amino]-ethylamino]ethanone.
| Compound Name | 1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-[[(Z)-(1-chloro-4,4,4-trifluorobutan-2-ylidene)amino]-ethylamino]ethanone |
|---|---|
| PubChem CID | 143061332 |
| Molecular Formula | C19H25Cl2F3N4O2 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-[[(Z)-(1-chloro-4,4,4-trifluorobutan-2-ylidene)amino]-ethylamino]ethanone |
| SMILES | CCN(CC(=O)N1CCN(c2ccc(Cl)c(OC)c2)CC1)/N=C(\CCl)CC(F)(F)F |
| InChI | InChI=1S/C19H25Cl2F3N4O2/c1-3-28(25-14(12-20)11-19(22,23)24)13-18(29)27-8-6-26(7-9-27)15-4-5-16(21)17(10-15)30-2/h4-5,10H,3,6-9,11-13H2,1-2H3/b25-14- |
| InChIKey | OQPSVBSPEIFAON-QFEZKATASA-N |
| XLogP | 3.87 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|