C21H29Cl2F2N5O2 — CID 143061760
acetylene;2-[1-aminopropan-2-yl-[(Z)-(3-chloro-1,1-difluoropropan-2-ylidene)amino]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 143061760) has the molecular formula C21H29Cl2F2N5O2 and a molecular weight of 492.40 g/mol. Its IUPAC name is acetylene;2-[1-aminopropan-2-yl-[(Z)-(3-chloro-1,1-difluoropropan-2-ylidene)amino]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | acetylene;2-[1-aminopropan-2-yl-[(Z)-(3-chloro-1,1-difluoropropan-2-ylidene)amino]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143061760 |
| Molecular Formula | C21H29Cl2F2N5O2 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | acetylene;2-[1-aminopropan-2-yl-[(Z)-(3-chloro-1,1-difluoropropan-2-ylidene)amino]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | C#C.COc1cc(N2CCN(C(=O)CN(/N=C(\CCl)C(F)F)C(C)CN)CC2)ccc1Cl |
| InChI | InChI=1S/C19H27Cl2F2N5O2.C2H2/c1-13(11-24)28(25-16(10-20)19(22)23)12-18(29)27-7-5-26(6-8-27)14-3-4-15(21)17(9-14)30-2;1-2/h3-4,9,13,19H,5-8,10-12,24H2,1-2H3;1-2H/b25-16+; |
| InChIKey | RIYYJZJPKJAKJR-SRTPWMEPSA-N |
| XLogP | 2.76 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|