C22H24Cl2N4O5 — CID 143413541
2-[5-chloro-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formylanilino]acetic acid (PubChem CID 143413541) has the molecular formula C22H24Cl2N4O5 and a molecular weight of 495.36 g/mol. Its IUPAC name is 2-[5-chloro-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formylanilino]acetic acid.
| Compound Name | 2-[5-chloro-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formylanilino]acetic acid |
|---|---|
| PubChem CID | 143413541 |
| Molecular Formula | C22H24Cl2N4O5 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-[5-chloro-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formylanilino]acetic acid |
| SMILES | COc1cc(N2CCN(C(=O)CNc3ccc(Cl)cc3N(C=O)CC(=O)O)CC2)ccc1Cl |
| InChI | InChI=1S/C22H24Cl2N4O5/c1-33-20-11-16(3-4-17(20)24)26-6-8-27(9-7-26)21(30)12-25-18-5-2-15(23)10-19(18)28(14-29)13-22(31)32/h2-5,10-11,14,25H,6-9,12-13H2,1H3,(H,31,32) |
| InChIKey | XKIFVWTVTJNHJO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|