C23H27ClN4O5 — CID 143413504
2-[2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formyl-5-methylanilino]acetic acid (PubChem CID 143413504) has the molecular formula C23H27ClN4O5 and a molecular weight of 474.95 g/mol. Its IUPAC name is 2-[2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formyl-5-methylanilino]acetic acid.
| Compound Name | 2-[2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formyl-5-methylanilino]acetic acid |
|---|---|
| PubChem CID | 143413504 |
| Molecular Formula | C23H27ClN4O5 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]amino]-N-formyl-5-methylanilino]acetic acid |
| SMILES | COc1cc(N2CCN(C(=O)CNc3ccc(C)cc3N(C=O)CC(=O)O)CC2)ccc1Cl |
| InChI | InChI=1S/C23H27ClN4O5/c1-16-3-6-19(20(11-16)28(15-29)14-23(31)32)25-13-22(30)27-9-7-26(8-10-27)17-4-5-18(24)21(12-17)33-2/h3-6,11-12,15,25H,7-10,13-14H2,1-2H3,(H,31,32) |
| InChIKey | ZSGDTDDEWRAKSF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|