C22H37ClN6O3 — CID 143061667
(2E)-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]pentanehydrazide;ethane (PubChem CID 143061667) has the molecular formula C22H37ClN6O3 and a molecular weight of 469.03 g/mol. Its IUPAC name is (2E)-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]pentanehydrazide;ethane.
| Compound Name | (2E)-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]pentanehydrazide;ethane |
|---|---|
| PubChem CID | 143061667 |
| Molecular Formula | C22H37ClN6O3 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (2E)-2-[[2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]pentanehydrazide;ethane |
| SMILES | CC.CCC/C(=N\N(CC)CC(=O)N1CCN(c2ccc(Cl)c(OC)c2)CC1)C(=O)NN |
| InChI | InChI=1S/C20H31ClN6O3.C2H6/c1-4-6-17(20(29)23-22)24-27(5-2)14-19(28)26-11-9-25(10-12-26)15-7-8-16(21)18(13-15)30-3;1-2/h7-8,13H,4-6,9-12,14,22H2,1-3H3,(H,23,29);1-2H3/b24-17+; |
| InChIKey | CQIIJEJRYLTASZ-HRKWZSCTSA-N |
| XLogP | 2.49 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|