C23H33Cl2F3N4O3 — CID 143061800
5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluorobutan-2-ylidene)amino]-ethylamino]acetyl]-1,4-diazepan-1-yl]-4-methoxybenzaldehyde;ethane (PubChem CID 143061800) has the molecular formula C23H33Cl2F3N4O3 and a molecular weight of 541.44 g/mol. Its IUPAC name is 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluorobutan-2-ylidene)amino]-ethylamino]acetyl]-1,4-diazepan-1-yl]-4-methoxybenzaldehyde;ethane.
| Compound Name | 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluorobutan-2-ylidene)amino]-ethylamino]acetyl]-1,4-diazepan-1-yl]-4-methoxybenzaldehyde;ethane |
|---|---|
| PubChem CID | 143061800 |
| Molecular Formula | C23H33Cl2F3N4O3 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluorobutan-2-ylidene)amino]-ethylamino]acetyl]-1,4-diazepan-1-yl]-4-methoxybenzaldehyde;ethane |
| SMILES | CC.CCN(CC(=O)N1CCCN(c2cc(OC)c(Cl)cc2C=O)CC1)/N=C(\C(C)Cl)C(F)(F)F |
| InChI | InChI=1S/C21H27Cl2F3N4O3.C2H6/c1-4-30(27-20(14(2)22)21(24,25)26)12-19(32)29-7-5-6-28(8-9-29)17-11-18(33-3)16(23)10-15(17)13-31;1-2/h10-11,13-14H,4-9,12H2,1-3H3;1-2H3/b27-20+; |
| InChIKey | LYWCCEJJVDGKCB-PQAWYCKWSA-N |
| XLogP | 5.09 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|