C24H31Cl2N5O2 — CID 143061796
1-[4-(4-chloro-3-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[(Z)-(1-chloro-3-pyridin-3-ylpropan-2-ylidene)amino]-ethylamino]ethanone (PubChem CID 143061796) has the molecular formula C24H31Cl2N5O2 and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-[4-(4-chloro-3-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[(Z)-(1-chloro-3-pyridin-3-ylpropan-2-ylidene)amino]-ethylamino]ethanone.
| Compound Name | 1-[4-(4-chloro-3-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[(Z)-(1-chloro-3-pyridin-3-ylpropan-2-ylidene)amino]-ethylamino]ethanone |
|---|---|
| PubChem CID | 143061796 |
| Molecular Formula | C24H31Cl2N5O2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-[4-(4-chloro-3-methoxyphenyl)-1,4-diazepan-1-yl]-2-[[(Z)-(1-chloro-3-pyridin-3-ylpropan-2-ylidene)amino]-ethylamino]ethanone |
| SMILES | CCN(CC(=O)N1CCCN(c2ccc(Cl)c(OC)c2)CC1)/N=C(\CCl)Cc1cccnc1 |
| InChI | InChI=1S/C24H31Cl2N5O2/c1-3-31(28-20(16-25)14-19-6-4-9-27-17-19)18-24(32)30-11-5-10-29(12-13-30)21-7-8-22(26)23(15-21)33-2/h4,6-9,15,17H,3,5,10-14,16,18H2,1-2H3/b28-20- |
| InChIKey | CSNZPMSLLPRNEK-RRAHZORUSA-N |
| XLogP | 3.94 |
| TPSA | 61.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|