C20H25Cl2F3N4O4 — CID 143061939
methyl 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]acetyl]piperazin-1-yl]-4-methoxybenzoate (PubChem CID 143061939) has the molecular formula C20H25Cl2F3N4O4 and a molecular weight of 513.34 g/mol. Its IUPAC name is methyl 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]acetyl]piperazin-1-yl]-4-methoxybenzoate.
| Compound Name | methyl 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]acetyl]piperazin-1-yl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 143061939 |
| Molecular Formula | C20H25Cl2F3N4O4 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | methyl 5-chloro-2-[4-[2-[[(Z)-(3-chloro-1,1,1-trifluoropropan-2-ylidene)amino]-ethylamino]acetyl]piperazin-1-yl]-4-methoxybenzoate |
| SMILES | CCN(CC(=O)N1CCN(c2cc(OC)c(Cl)cc2C(=O)OC)CC1)/N=C(\CCl)C(F)(F)F |
| InChI | InChI=1S/C20H25Cl2F3N4O4/c1-4-29(26-17(11-21)20(23,24)25)12-18(30)28-7-5-27(6-8-28)15-10-16(32-2)14(22)9-13(15)19(31)33-3/h9-10H,4-8,11-12H2,1-3H3/b26-17+ |
| InChIKey | XYUXTKVJTPEVRF-YZSQISJMSA-N |
| XLogP | 3.26 |
| TPSA | 74.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|