C27H41ClF3N5O4 — CID 143061731
chloromethane;2-[4-[2-[ethyl-[(E)-(1,1,1-trifluoro-3-methylbut-3-en-2-ylidene)amino]amino]acetyl]-1,4-diazepan-1-yl]-4-methoxy-N-(2-methoxyethyl)-5-methylbenzamide (PubChem CID 143061731) has the molecular formula C27H41ClF3N5O4 and a molecular weight of 592.10 g/mol. Its IUPAC name is chloromethane;2-[4-[2-[ethyl-[(E)-(1,1,1-trifluoro-3-methylbut-3-en-2-ylidene)amino]amino]acetyl]-1,4-diazepan-1-yl]-4-methoxy-N-(2-methoxyethyl)-5-methylbenzamide.
| Compound Name | chloromethane;2-[4-[2-[ethyl-[(E)-(1,1,1-trifluoro-3-methylbut-3-en-2-ylidene)amino]amino]acetyl]-1,4-diazepan-1-yl]-4-methoxy-N-(2-methoxyethyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 143061731 |
| Molecular Formula | C27H41ClF3N5O4 |
| Molecular Weight | 592.10 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | chloromethane;2-[4-[2-[ethyl-[(E)-(1,1,1-trifluoro-3-methylbut-3-en-2-ylidene)amino]amino]acetyl]-1,4-diazepan-1-yl]-4-methoxy-N-(2-methoxyethyl)-5-methylbenzamide |
| SMILES | C=C(C)/C(=N\N(CC)CC(=O)N1CCCN(c2cc(OC)c(C)cc2C(=O)NCCOC)CC1)C(F)(F)F.CCl |
| InChI | InChI=1S/C26H38F3N5O4.CH3Cl/c1-7-34(31-24(18(2)3)26(27,28)29)17-23(35)33-11-8-10-32(12-13-33)21-16-22(38-6)19(4)15-20(21)25(36)30-9-14-37-5;1-2/h15-16H,2,7-14,17H2,1,3-6H3,(H,30,36);1H3/b31-24+; |
| InChIKey | LZPOAPACZYXLEN-HRTMWWCNSA-N |
| XLogP | 4.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.10 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|