C20H22ClN4O2+ — CID 58644935
1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-imidazo[1,2-a]pyridin-1-ium-1-ylethanone (PubChem CID 58644935) has the molecular formula C20H22ClN4O2+ and a molecular weight of 385.88 g/mol. Its IUPAC name is 1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-imidazo[1,2-a]pyridin-1-ium-1-ylethanone.
| Compound Name | 1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-imidazo[1,2-a]pyridin-1-ium-1-ylethanone |
|---|---|
| PubChem CID | 58644935 |
| Molecular Formula | C20H22ClN4O2+ |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-imidazo[1,2-a]pyridin-1-ium-1-ylethanone |
| SMILES | COc1cc(N2CCN(C(=O)C[n+]3ccn4ccccc43)CC2)ccc1Cl |
| InChI | InChI=1S/C20H22ClN4O2/c1-27-18-14-16(5-6-17(18)21)22-8-11-24(12-9-22)20(26)15-25-13-10-23-7-3-2-4-19(23)25/h2-7,10,13-14H,8-9,11-12,15H2,1H3/q+1 |
| InChIKey | ZRYZQNFORBNHBB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|