C23H29Cl2N5O3 — CID 143061325
2-[amino-[(E)-3-chloro-4-pyridin-2-yloxypent-2-en-2-yl]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 143061325) has the molecular formula C23H29Cl2N5O3 and a molecular weight of 494.42 g/mol. Its IUPAC name is 2-[amino-[(E)-3-chloro-4-pyridin-2-yloxypent-2-en-2-yl]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[amino-[(E)-3-chloro-4-pyridin-2-yloxypent-2-en-2-yl]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143061325 |
| Molecular Formula | C23H29Cl2N5O3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[amino-[(E)-3-chloro-4-pyridin-2-yloxypent-2-en-2-yl]amino]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1cc(N2CCN(C(=O)CN(N)/C(C)=C(/Cl)C(C)Oc3ccccn3)CC2)ccc1Cl |
| InChI | InChI=1S/C23H29Cl2N5O3/c1-16(23(25)17(2)33-21-6-4-5-9-27-21)30(26)15-22(31)29-12-10-28(11-13-29)18-7-8-19(24)20(14-18)32-3/h4-9,14,17H,10-13,15,26H2,1-3H3/b23-16+ |
| InChIKey | AEYDEIYUSHARSN-XQNSMLJCSA-N |
| XLogP | 3.51 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|