C13H19NO — CID 143443361
4-[(2Z)-2-propa-1,2-dienylpenta-2,4-dienyl]piperidin-4-ol (PubChem CID 143443361) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-[(2Z)-2-propa-1,2-dienylpenta-2,4-dienyl]piperidin-4-ol.
| Compound Name | 4-[(2Z)-2-propa-1,2-dienylpenta-2,4-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 143443361 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-[(2Z)-2-propa-1,2-dienylpenta-2,4-dienyl]piperidin-4-ol |
| SMILES | C=C=C/C(=C\C=C)CC1(O)CCNCC1 |
| InChI | InChI=1S/C13H19NO/c1-3-5-12(6-4-2)11-13(15)7-9-14-10-8-13/h3,5-6,14-15H,1-2,7-11H2/b12-5+ |
| InChIKey | SYQONDMLJNLVGE-LFYBBSHMSA-N |
| XLogP | 1.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|