About 4-phenylpiperidin-4-ol;yttrium
4-phenylpiperidin-4-ol;yttrium (PubChem CID 58814120) has the molecular formula C11H14NOY-
and a molecular weight of 265.14 g/mol. Its IUPAC name is 4-phenylpiperidin-4-ol;yttrium.
Molecular Properties
| Compound Name | 4-phenylpiperidin-4-ol;yttrium |
| PubChem CID | 58814120 |
| Molecular Formula | C11H14NOY- |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 4-phenylpiperidin-4-ol;yttrium |
| SMILES | OC1(c2cc[c-]cc2)CCNCC1.[Y] |
| InChI | InChI=1S/C11H14NO.Y/c13-11(6-8-12-9-7-11)10-4-2-1-3-5-10;/h2-5,12-13H,6-9H2;/q-1; |
| InChIKey | NGRXIGRSCJVUKI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylpiperidin-4-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpiperidin-4-ol;yttrium?
The IUPAC name of 4-phenylpiperidin-4-ol;yttrium (CID 58814120) is 4-phenylpiperidin-4-ol;yttrium.
What is the SMILES notation for 4-phenylpiperidin-4-ol;yttrium?
The canonical SMILES for 4-phenylpiperidin-4-ol;yttrium is OC1(c2cc[c-]cc2)CCNCC1.[Y].
What is the InChIKey of 4-phenylpiperidin-4-ol;yttrium?
The InChIKey is NGRXIGRSCJVUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO.Y/c13-11(6-8-12-9-7-11)10-4-2-1-3-5-10;/h2-5,12-13H,6-9H2;/q-1;.
What are the key properties of 4-phenylpiperidin-4-ol;yttrium?
4-phenylpiperidin-4-ol;yttrium has a molecular weight of 265.14 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpiperidin-4-ol;yttrium is sourced from PubChem (CID 58814120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).