C21H20N2OS — CID 143444623
2-(4-methoxy-2-pyridinyl)-4-[(E)-2-(4-methylsulfanylphenyl)prop-1-enyl]pyridine (PubChem CID 143444623) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-(4-methoxy-2-pyridinyl)-4-[(E)-2-(4-methylsulfanylphenyl)prop-1-enyl]pyridine.
| Compound Name | 2-(4-methoxy-2-pyridinyl)-4-[(E)-2-(4-methylsulfanylphenyl)prop-1-enyl]pyridine |
|---|---|
| PubChem CID | 143444623 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-(4-methoxy-2-pyridinyl)-4-[(E)-2-(4-methylsulfanylphenyl)prop-1-enyl]pyridine |
| SMILES | COc1ccnc(-c2cc(/C=C(\C)c3ccc(SC)cc3)ccn2)c1 |
| InChI | InChI=1S/C21H20N2OS/c1-15(17-4-6-19(25-3)7-5-17)12-16-8-10-22-20(13-16)21-14-18(24-2)9-11-23-21/h4-14H,1-3H3/b15-12+ |
| InChIKey | PHHVRVDJFMYRGR-NTCAYCPXSA-N |
| XLogP | 5.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |