C19H20N4O2S — CID 122205488
2-[[2,6-bis(4-methoxy-2-pyridinyl)-4-pyridinyl]sulfanyl]ethanamine (PubChem CID 122205488) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[[2,6-bis(4-methoxy-2-pyridinyl)-4-pyridinyl]sulfanyl]ethanamine.
| Compound Name | 2-[[2,6-bis(4-methoxy-2-pyridinyl)-4-pyridinyl]sulfanyl]ethanamine |
|---|---|
| PubChem CID | 122205488 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[[2,6-bis(4-methoxy-2-pyridinyl)-4-pyridinyl]sulfanyl]ethanamine |
| SMILES | COc1ccnc(-c2cc(SCCN)cc(-c3cc(OC)ccn3)n2)c1 |
| InChI | InChI=1S/C19H20N4O2S/c1-24-13-3-6-21-16(9-13)18-11-15(26-8-5-20)12-19(23-18)17-10-14(25-2)4-7-22-17/h3-4,6-7,9-12H,5,8,20H2,1-2H3 |
| InChIKey | GSPWTGMNOWDXDS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |