About N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide
N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 143445165) has the molecular formula C18H24IN3OS
and a molecular weight of 457.38 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 143445165 |
| Molecular Formula | C18H24IN3OS |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)CCN(C)C(=O)c1sc(-c2ccc(I)cc2)nc1C |
| InChI | InChI=1S/C18H24IN3OS/c1-5-22(6-2)12-11-21(4)18(23)16-13(3)20-17(24-16)14-7-9-15(19)10-8-14/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | OMNOUNNHPPEYEN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (CID 143445165) is N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is CCN(CC)CCN(C)C(=O)c1sc(-c2ccc(I)cc2)nc1C.
What is the InChIKey of N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is OMNOUNNHPPEYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24IN3OS/c1-5-22(6-2)12-11-21(4)18(23)16-13(3)20-17(24-16)14-7-9-15(19)10-8-14/h7-10H,5-6,11-12H2,1-4H3.
What are the key properties of N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 457.38 g/mol, XLogP of 4.14, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 143445165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).