C18H24IN3OS — CID 143445165
N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 143445165) has the molecular formula C18H24IN3OS and a molecular weight of 457.38 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 143445165 |
| Molecular Formula | C18H24IN3OS |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(4-iodophenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)CCN(C)C(=O)c1sc(-c2ccc(I)cc2)nc1C |
| InChI | InChI=1S/C18H24IN3OS/c1-5-22(6-2)12-11-21(4)18(23)16-13(3)20-17(24-16)14-7-9-15(19)10-8-14/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | OMNOUNNHPPEYEN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|