About 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide
2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide (PubChem CID 143281454) has the molecular formula C19H26N2OS
and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 143281454 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCc1ccc(-c2nc(C)c(C(=O)N(C)CCC)s2)cc1 |
| InChI | InChI=1S/C19H26N2OS/c1-5-7-8-15-9-11-16(12-10-15)18-20-14(3)17(23-18)19(22)21(4)13-6-2/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | AWFPJHIKTSGWAT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide (CID 143281454) is 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide is CCCCc1ccc(-c2nc(C)c(C(=O)N(C)CCC)s2)cc1.
What is the InChIKey of 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide?
The InChIKey is AWFPJHIKTSGWAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2OS/c1-5-7-8-15-9-11-16(12-10-15)18-20-14(3)17(23-18)19(22)21(4)13-6-2/h9-12H,5-8,13H2,1-4H3.
What are the key properties of 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide?
2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide has a molecular weight of 330.50 g/mol, XLogP of 4.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-butylphenyl)-N,4-dimethyl-N-propyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 143281454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).