C21H21FN2O2S — CID 46440106
2-(4-fluorophenyl)-N,4-dimethyl-N-(3-phenoxypropyl)-1,3-thiazole-5-carboxamide (PubChem CID 46440106) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,4-dimethyl-N-(3-phenoxypropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N,4-dimethyl-N-(3-phenoxypropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46440106 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(4-fluorophenyl)-N,4-dimethyl-N-(3-phenoxypropyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)N(C)CCCOc1ccccc1 |
| InChI | InChI=1S/C21H21FN2O2S/c1-15-19(27-20(23-15)16-9-11-17(22)12-10-16)21(25)24(2)13-6-14-26-18-7-4-3-5-8-18/h3-5,7-12H,6,13-14H2,1-2H3 |
| InChIKey | PIBGZVVDAPFUJU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|