C16H21N5OS — CID 90107748
2-(4-butylphenyl)-N-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 90107748) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-(4-butylphenyl)-N-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-butylphenyl)-N-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90107748 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(4-butylphenyl)-N-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCc1ccc(-c2nc(C)c(C(=O)NN=C(N)N)s2)cc1 |
| InChI | InChI=1S/C16H21N5OS/c1-3-4-5-11-6-8-12(9-7-11)15-19-10(2)13(23-15)14(22)20-21-16(17)18/h6-9H,3-5H2,1-2H3,(H,20,22)(H4,17,18,21) |
| InChIKey | NZTIZVMTSCAWFL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|