C28H24Cl2N2OS — CID 143446448
6-[(2E,4Z)-6-chloro-2-methylhexa-2,4-dienyl]-N-[(2-chlorophenyl)methyl]benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 143446448) has the molecular formula C28H24Cl2N2OS and a molecular weight of 507.49 g/mol. Its IUPAC name is 6-[(2E,4Z)-6-chloro-2-methylhexa-2,4-dienyl]-N-[(2-chlorophenyl)methyl]benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-[(2E,4Z)-6-chloro-2-methylhexa-2,4-dienyl]-N-[(2-chlorophenyl)methyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 143446448 |
| Molecular Formula | C28H24Cl2N2OS |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 6-[(2E,4Z)-6-chloro-2-methylhexa-2,4-dienyl]-N-[(2-chlorophenyl)methyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | C/C(=C\C=C/CCl)CC1=Nc2cc(C(=O)NCc3ccccc3Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C28H24Cl2N2OS/c1-19(8-6-7-15-29)16-24-22-10-3-5-12-26(22)34-27-14-13-20(17-25(27)32-24)28(33)31-18-21-9-2-4-11-23(21)30/h2-14,17H,15-16,18H2,1H3,(H,31,33)/b7-6-,19-8+ |
| InChIKey | FGZUZNPWZHAVFK-HOWRVZNXSA-N |
| XLogP | 7.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|