C28H26N4OS — CID 143446506
4-(2,3-dimethyl-1,4-benzothiazepin-5-yl)benzonitrile;N-(pyridin-4-ylmethyl)but-3-enamide (PubChem CID 143446506) has the molecular formula C28H26N4OS and a molecular weight of 466.61 g/mol. Its IUPAC name is 4-(2,3-dimethyl-1,4-benzothiazepin-5-yl)benzonitrile;N-(pyridin-4-ylmethyl)but-3-enamide.
| Compound Name | 4-(2,3-dimethyl-1,4-benzothiazepin-5-yl)benzonitrile;N-(pyridin-4-ylmethyl)but-3-enamide |
|---|---|
| PubChem CID | 143446506 |
| Molecular Formula | C28H26N4OS |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-(2,3-dimethyl-1,4-benzothiazepin-5-yl)benzonitrile;N-(pyridin-4-ylmethyl)but-3-enamide |
| SMILES | C=CCC(=O)NCc1ccncc1.CC1=C(C)Sc2ccccc2C(c2ccc(C#N)cc2)=N1 |
| InChI | InChI=1S/C18H14N2S.C10H12N2O/c1-12-13(2)21-17-6-4-3-5-16(17)18(20-12)15-9-7-14(11-19)8-10-15;1-2-3-10(13)12-8-9-4-6-11-7-5-9/h3-10H,1-2H3;2,4-7H,1,3,8H2,(H,12,13) |
| InChIKey | DQLOBAXFZUXSFE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|