C29H30BrN3OS — CID 143446443
N'-benzylbut-3-enehydrazide;5-(5-bromocyclohepta-1,4,6-trien-1-yl)-2,3-dimethyl-1,4-benzothiazepine (PubChem CID 143446443) has the molecular formula C29H30BrN3OS and a molecular weight of 548.55 g/mol. Its IUPAC name is N'-benzylbut-3-enehydrazide;5-(5-bromocyclohepta-1,4,6-trien-1-yl)-2,3-dimethyl-1,4-benzothiazepine.
| Compound Name | N'-benzylbut-3-enehydrazide;5-(5-bromocyclohepta-1,4,6-trien-1-yl)-2,3-dimethyl-1,4-benzothiazepine |
|---|---|
| PubChem CID | 143446443 |
| Molecular Formula | C29H30BrN3OS |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | N'-benzylbut-3-enehydrazide;5-(5-bromocyclohepta-1,4,6-trien-1-yl)-2,3-dimethyl-1,4-benzothiazepine |
| SMILES | C=CCC(=O)NNCc1ccccc1.CC1=C(C)Sc2ccccc2C(C2=CCC=C(Br)C=C2)=N1 |
| InChI | InChI=1S/C18H16BrNS.C11H14N2O/c1-12-13(2)21-17-9-4-3-8-16(17)18(20-12)14-6-5-7-15(19)11-10-14;1-2-6-11(14)13-12-9-10-7-4-3-5-8-10/h3-4,6-11H,5H2,1-2H3;2-5,7-8,12H,1,6,9H2,(H,13,14) |
| InChIKey | JDDQIELSEUDVPU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|