C24H24N2OS — CID 71055334
N-butyl-6-phenyl-2,3-dihydrobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 71055334) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is N-butyl-6-phenyl-2,3-dihydrobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-butyl-6-phenyl-2,3-dihydrobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 71055334 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-butyl-6-phenyl-2,3-dihydrobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)C1C=C2N=C(c3ccccc3)c3ccccc3SC2=CC1 |
| InChI | InChI=1S/C24H24N2OS/c1-2-3-15-25-24(27)18-13-14-22-20(16-18)26-23(17-9-5-4-6-10-17)19-11-7-8-12-21(19)28-22/h4-12,14,16,18H,2-3,13,15H2,1H3,(H,25,27) |
| InChIKey | VFQUTCQXPKXKPN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|