C28H20BrN3O2S — CID 58872247
6-(4-bromophenyl)-N'-(2-phenylacetyl)benzo[b][1,4]benzothiazepine-3-carbohydrazide (PubChem CID 58872247) has the molecular formula C28H20BrN3O2S and a molecular weight of 542.46 g/mol. Its IUPAC name is 6-(4-bromophenyl)-N'-(2-phenylacetyl)benzo[b][1,4]benzothiazepine-3-carbohydrazide.
| Compound Name | 6-(4-bromophenyl)-N'-(2-phenylacetyl)benzo[b][1,4]benzothiazepine-3-carbohydrazide |
|---|---|
| PubChem CID | 58872247 |
| Molecular Formula | C28H20BrN3O2S |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 6-(4-bromophenyl)-N'-(2-phenylacetyl)benzo[b][1,4]benzothiazepine-3-carbohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)c1ccc2c(c1)N=C(c1ccc(Br)cc1)c1ccccc1S2 |
| InChI | InChI=1S/C28H20BrN3O2S/c29-21-13-10-19(11-14-21)27-22-8-4-5-9-24(22)35-25-15-12-20(17-23(25)30-27)28(34)32-31-26(33)16-18-6-2-1-3-7-18/h1-15,17H,16H2,(H,31,33)(H,32,34) |
| InChIKey | ZIBAXXWBQVYQGS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|