C20H13FN2OS — CID 145482894
6-(4-fluorophenyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 145482894) has the molecular formula C20H13FN2OS and a molecular weight of 348.40 g/mol. Its IUPAC name is 6-(4-fluorophenyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-(4-fluorophenyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 145482894 |
| Molecular Formula | C20H13FN2OS |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6-(4-fluorophenyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)N=C(c1ccc(F)cc1)c1ccccc1S2 |
| InChI | InChI=1S/C20H13FN2OS/c21-14-8-5-12(6-9-14)19-15-3-1-2-4-17(15)25-18-10-7-13(20(22)24)11-16(18)23-19/h1-11H,(H2,22,24) |
| InChIKey | COSZEWPBXUBNMK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |