C22H17FN2O2S — CID 58872322
6-(2-fluorophenyl)-N-methoxy-N-methylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 58872322) has the molecular formula C22H17FN2O2S and a molecular weight of 392.46 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-N-methoxy-N-methylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-(2-fluorophenyl)-N-methoxy-N-methylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 58872322 |
| Molecular Formula | C22H17FN2O2S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-(2-fluorophenyl)-N-methoxy-N-methylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CON(C)C(=O)c1ccc2c(c1)N=C(c1ccccc1F)c1ccccc1S2 |
| InChI | InChI=1S/C22H17FN2O2S/c1-25(27-2)22(26)14-11-12-20-18(13-14)24-21(15-7-3-5-9-17(15)23)16-8-4-6-10-19(16)28-20/h3-13H,1-2H3 |
| InChIKey | KIWOEQKZNSKAMR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|