C26H25N3O2S — CID 145482707
N-(azepan-1-yl)-6-(3-hydroxyphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 145482707) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-(azepan-1-yl)-6-(3-hydroxyphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-(azepan-1-yl)-6-(3-hydroxyphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 145482707 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-(azepan-1-yl)-6-(3-hydroxyphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NN1CCCCCC1)c1ccc2c(c1)N=C(c1cccc(O)c1)c1ccccc1S2 |
| InChI | InChI=1S/C26H25N3O2S/c30-20-9-7-8-18(16-20)25-21-10-3-4-11-23(21)32-24-13-12-19(17-22(24)27-25)26(31)28-29-14-5-1-2-6-15-29/h3-4,7-13,16-17,30H,1-2,5-6,14-15H2,(H,28,31) |
| InChIKey | LTDXUDMYHVJBQX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |