C23H21N5OS — CID 25012349
6-phenyl-N-piperidin-1-ylpyrimido[5,4-b][1,4]benzothiazepine-3-carboxamide (PubChem CID 25012349) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 6-phenyl-N-piperidin-1-ylpyrimido[5,4-b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-phenyl-N-piperidin-1-ylpyrimido[5,4-b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 25012349 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-phenyl-N-piperidin-1-ylpyrimido[5,4-b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NN1CCCCC1)c1ncc2c(n1)N=C(c1ccccc1)c1ccccc1S2 |
| InChI | InChI=1S/C23H21N5OS/c29-23(27-28-13-7-2-8-14-28)22-24-15-19-21(26-22)25-20(16-9-3-1-4-10-16)17-11-5-6-12-18(17)30-19/h1,3-6,9-12,15H,2,7-8,13-14H2,(H,27,29) |
| InChIKey | UOUJSQWOYWUXLG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |