C18H23NO2 — CID 143447868
benzyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N-ethylcarbamate (PubChem CID 143447868) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is benzyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N-ethylcarbamate.
| Compound Name | benzyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 143447868 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | benzyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]-N-ethylcarbamate |
| SMILES | C=C/C=C(\C=C)CCN(CC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO2/c1-4-10-16(5-2)13-14-19(6-3)18(20)21-15-17-11-8-7-9-12-17/h4-5,7-12H,1-2,6,13-15H2,3H3/b16-10+ |
| InChIKey | QRBHYEDXONZJOT-MHWRWJLKSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|