C18H24N2O6 — CID 121344890
methyl 2-[3-[ethyl(phenylmethoxycarbonyl)amino]propanoylamino]-3-oxobutanoate (PubChem CID 121344890) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 2-[3-[ethyl(phenylmethoxycarbonyl)amino]propanoylamino]-3-oxobutanoate.
| Compound Name | methyl 2-[3-[ethyl(phenylmethoxycarbonyl)amino]propanoylamino]-3-oxobutanoate |
|---|---|
| PubChem CID | 121344890 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 2-[3-[ethyl(phenylmethoxycarbonyl)amino]propanoylamino]-3-oxobutanoate |
| SMILES | CCN(CCC(=O)NC(C(C)=O)C(=O)OC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O6/c1-4-20(18(24)26-12-14-8-6-5-7-9-14)11-10-15(22)19-16(13(2)21)17(23)25-3/h5-9,16H,4,10-12H2,1-3H3,(H,19,22) |
| InChIKey | VDTCNNZLBIPHLK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|