C15H26N2O3S — CID 143447965
ethane;methanamine;(5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfinate (PubChem CID 143447965) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is ethane;methanamine;(5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfinate.
| Compound Name | ethane;methanamine;(5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 143447965 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethane;methanamine;(5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfinate |
| SMILES | CC.CN.Cc1ccc(S(=O)OCC2CCC(=O)N2)cc1 |
| InChI | InChI=1S/C12H15NO3S.C2H6.CH5N/c1-9-2-5-11(6-3-9)17(15)16-8-10-4-7-12(14)13-10;2*1-2/h2-3,5-6,10H,4,7-8H2,1H3,(H,13,14);1-2H3;2H2,1H3 |
| InChIKey | GTQXROAZKWVJAB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |