C19H26F2N4O2 — CID 143448591
(2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal (PubChem CID 143448591) has the molecular formula C19H26F2N4O2 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal.
| Compound Name | (2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal |
|---|---|
| PubChem CID | 143448591 |
| Molecular Formula | C19H26F2N4O2 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal |
| SMILES | C/C(C=O)=C1\C(O)N2CCCN2CN1/C=C/CNCC1CC=C(F)C=C1F |
| InChI | InChI=1S/C19H26F2N4O2/c1-14(12-26)18-19(27)25-9-3-8-24(25)13-23(18)7-2-6-22-11-15-4-5-16(20)10-17(15)21/h2,5,7,10,12,15,19,22,27H,3-4,6,8-9,11,13H2,1H3/b7-2+,18-14- |
| InChIKey | QZCQGPAXAIWXJS-AQYZAPEZSA-N |
| XLogP | 1.80 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|