C16H20N4O — CID 143449211
N,3-dimethyl-N-(2-morpholin-4-yl-3-pyridinyl)pyridin-2-amine (PubChem CID 143449211) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N,3-dimethyl-N-(2-morpholin-4-yl-3-pyridinyl)pyridin-2-amine.
| Compound Name | N,3-dimethyl-N-(2-morpholin-4-yl-3-pyridinyl)pyridin-2-amine |
|---|---|
| PubChem CID | 143449211 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N,3-dimethyl-N-(2-morpholin-4-yl-3-pyridinyl)pyridin-2-amine |
| SMILES | Cc1cccnc1N(C)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C16H20N4O/c1-13-5-3-7-17-15(13)19(2)14-6-4-8-18-16(14)20-9-11-21-12-10-20/h3-8H,9-12H2,1-2H3 |
| InChIKey | PSHZDVWKGBENTJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |