C12H11NO2 — CID 143451318
5-cyclohexa-1,5-dien-1-yloxypyridine-2-carbaldehyde (PubChem CID 143451318) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yloxypyridine-2-carbaldehyde.
| Compound Name | 5-cyclohexa-1,5-dien-1-yloxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143451318 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yloxypyridine-2-carbaldehyde |
| SMILES | O=Cc1ccc(OC2=CCCC=C2)cn1 |
| InChI | InChI=1S/C12H11NO2/c14-9-10-6-7-12(8-13-10)15-11-4-2-1-3-5-11/h2,4-9H,1,3H2 |
| InChIKey | GTTWZEMPFZXSLI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|