C20H24N2O2 — CID 143451704
N-methyl-N-[1-(2-methyl-5-nitrophenyl)propyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 143451704) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-methyl-N-[1-(2-methyl-5-nitrophenyl)propyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-methyl-N-[1-(2-methyl-5-nitrophenyl)propyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 143451704 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-methyl-N-[1-(2-methyl-5-nitrophenyl)propyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCC(c1cc([N+](=O)[O-])ccc1C)N(C)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H24N2O2/c1-4-20(19-13-17(22(23)24)10-9-14(19)2)21(3)18-11-15-7-5-6-8-16(15)12-18/h5-10,13,18,20H,4,11-12H2,1-3H3 |
| InChIKey | JRPRMJQVFCZZCC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|