C15H24N2O4 — CID 110009344
2-methyl-2-[[methyl-[1-(2-methyl-5-nitrophenyl)ethyl]amino]methyl]propane-1,3-diol (PubChem CID 110009344) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-methyl-2-[[methyl-[1-(2-methyl-5-nitrophenyl)ethyl]amino]methyl]propane-1,3-diol.
| Compound Name | 2-methyl-2-[[methyl-[1-(2-methyl-5-nitrophenyl)ethyl]amino]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 110009344 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-methyl-2-[[methyl-[1-(2-methyl-5-nitrophenyl)ethyl]amino]methyl]propane-1,3-diol |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(C)N(C)CC(C)(CO)CO |
| InChI | InChI=1S/C15H24N2O4/c1-11-5-6-13(17(20)21)7-14(11)12(2)16(4)8-15(3,9-18)10-19/h5-7,12,18-19H,8-10H2,1-4H3 |
| InChIKey | SCYOCBOJZWLQTE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|