C13H17FS — CID 143452517
ethane;6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene (PubChem CID 143452517) has the molecular formula C13H17FS and a molecular weight of 224.34 g/mol. Its IUPAC name is ethane;6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene.
| Compound Name | ethane;6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 143452517 |
| Molecular Formula | C13H17FS |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | ethane;6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene |
| SMILES | CC.Cc1sc2c(c1C)=CCC(F)=CC=2 |
| InChI | InChI=1S/C11H11FS.C2H6/c1-7-8(2)13-11-6-4-9(12)3-5-10(7)11;1-2/h4-6H,3H2,1-2H3;1-2H3 |
| InChIKey | HGAUEZXSWCZMIT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |