C11H11FS — CID 143452518
6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene (PubChem CID 143452518) has the molecular formula C11H11FS and a molecular weight of 194.27 g/mol. Its IUPAC name is 6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene.
| Compound Name | 6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene |
|---|---|
| PubChem CID | 143452518 |
| Molecular Formula | C11H11FS |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 6-fluoro-2,3-dimethyl-5H-cyclohepta[b]thiophene |
| SMILES | Cc1sc2c(c1C)=CCC(F)=CC=2 |
| InChI | InChI=1S/C11H11FS/c1-7-8(2)13-11-6-4-9(12)3-5-10(7)11/h4-6H,3H2,1-2H3 |
| InChIKey | AGUBPRNAEUPGNP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |