C14H15N3OS2 — CID 143452729
[(E)-prop-1-enyl] N'-[3-(thiophen-2-ylmethoxy)-2-pyridinyl]carbamimidothioate (PubChem CID 143452729) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is [(E)-prop-1-enyl] N'-[3-(thiophen-2-ylmethoxy)-2-pyridinyl]carbamimidothioate.
| Compound Name | [(E)-prop-1-enyl] N'-[3-(thiophen-2-ylmethoxy)-2-pyridinyl]carbamimidothioate |
|---|---|
| PubChem CID | 143452729 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | [(E)-prop-1-enyl] N'-[3-(thiophen-2-ylmethoxy)-2-pyridinyl]carbamimidothioate |
| SMILES | C/C=C/S/C(N)=N\c1ncccc1OCc1cccs1 |
| InChI | InChI=1S/C14H15N3OS2/c1-2-8-20-14(15)17-13-12(6-3-7-16-13)18-10-11-5-4-9-19-11/h2-9H,10H2,1H3,(H2,15,16,17)/b8-2+ |
| InChIKey | RQUFGTGHGLNDOX-KRXBUXKQSA-N |
| XLogP | 3.94 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|