About [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate
[(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate (PubChem CID 143556187) has the molecular formula C21H28N4OS
and a molecular weight of 384.55 g/mol. Its IUPAC name is [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate.
Molecular Properties
| Compound Name | [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate |
| PubChem CID | 143556187 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate |
| SMILES | C/C=C/S/C(N)=N\c1ncc(CCCCN(C)C)cc1Oc1ccccc1 |
| InChI | InChI=1S/C21H28N4OS/c1-4-14-27-21(22)24-20-19(26-18-11-6-5-7-12-18)15-17(16-23-20)10-8-9-13-25(2)3/h4-7,11-12,14-16H,8-10,13H2,1-3H3,(H2,22,23,24)/b14-4+ |
| InChIKey | FIKCZPOZJLBXLJ-LNKIKWGQSA-N |
| XLogP | 4.97 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate?
The IUPAC name of [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate (CID 143556187) is [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate.
What is the SMILES notation for [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate?
The canonical SMILES for [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate is C/C=C/S/C(N)=N\c1ncc(CCCCN(C)C)cc1Oc1ccccc1.
What is the InChIKey of [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate?
The InChIKey is FIKCZPOZJLBXLJ-LNKIKWGQSA-N. The full InChI is InChI=1S/C21H28N4OS/c1-4-14-27-21(22)24-20-19(26-18-11-6-5-7-12-18)15-17(16-23-20)10-8-9-13-25(2)3/h4-7,11-12,14-16H,8-10,13H2,1-3H3,(H2,22,23,24)/b14-4+.
What are the key properties of [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate?
[(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate has a molecular weight of 384.55 g/mol, XLogP of 4.97, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-prop-1-enyl] N'-[5-[4-(dimethylamino)butyl]-3-phenoxy-2-pyridinyl]carbamimidothioate is sourced from PubChem (CID 143556187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).