C24H24N4O2S — CID 143648163
N-[(Z)-6-oxohex-2-en-3-yl]-N'-(3-phenoxy-5-pyridin-4-ylsulfanyl-2-pyridinyl)ethanimidamide (PubChem CID 143648163) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[(Z)-6-oxohex-2-en-3-yl]-N'-(3-phenoxy-5-pyridin-4-ylsulfanyl-2-pyridinyl)ethanimidamide.
| Compound Name | N-[(Z)-6-oxohex-2-en-3-yl]-N'-(3-phenoxy-5-pyridin-4-ylsulfanyl-2-pyridinyl)ethanimidamide |
|---|---|
| PubChem CID | 143648163 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[(Z)-6-oxohex-2-en-3-yl]-N'-(3-phenoxy-5-pyridin-4-ylsulfanyl-2-pyridinyl)ethanimidamide |
| SMILES | C/C=C(/CCC=O)N/C(C)=N/c1ncc(Sc2ccncc2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-3-19(8-7-15-29)27-18(2)28-24-23(30-20-9-5-4-6-10-20)16-22(17-26-24)31-21-11-13-25-14-12-21/h3-6,9-17H,7-8H2,1-2H3,(H,26,27,28)/b19-3- |
| InChIKey | IDYXMEUBNQSQDR-OQOIWIOPSA-N |
| XLogP | 5.94 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|