About (3-phenoxy-4-pyridinyl) propanoate
(3-phenoxy-4-pyridinyl) propanoate (PubChem CID 19755132) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is (3-phenoxy-4-pyridinyl) propanoate.
Molecular Properties
| Compound Name | (3-phenoxy-4-pyridinyl) propanoate |
| PubChem CID | 19755132 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (3-phenoxy-4-pyridinyl) propanoate |
| SMILES | CCC(=O)Oc1ccncc1Oc1ccccc1 |
| InChI | InChI=1S/C14H13NO3/c1-2-14(16)18-12-8-9-15-10-13(12)17-11-6-4-3-5-7-11/h3-10H,2H2,1H3 |
| InChIKey | TYOOSICWZBBAMQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenoxy-4-pyridinyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxy-4-pyridinyl) propanoate?
The IUPAC name of (3-phenoxy-4-pyridinyl) propanoate (CID 19755132) is (3-phenoxy-4-pyridinyl) propanoate.
What is the SMILES notation for (3-phenoxy-4-pyridinyl) propanoate?
The canonical SMILES for (3-phenoxy-4-pyridinyl) propanoate is CCC(=O)Oc1ccncc1Oc1ccccc1.
What is the InChIKey of (3-phenoxy-4-pyridinyl) propanoate?
The InChIKey is TYOOSICWZBBAMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-2-14(16)18-12-8-9-15-10-13(12)17-11-6-4-3-5-7-11/h3-10H,2H2,1H3.
What are the key properties of (3-phenoxy-4-pyridinyl) propanoate?
(3-phenoxy-4-pyridinyl) propanoate has a molecular weight of 243.26 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxy-4-pyridinyl) propanoate is sourced from PubChem (CID 19755132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).