About (4-methyl-3-pyridinyl) propanoate
(4-methyl-3-pyridinyl) propanoate (PubChem CID 175779158) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is (4-methyl-3-pyridinyl) propanoate.
Molecular Properties
| Compound Name | (4-methyl-3-pyridinyl) propanoate |
| PubChem CID | 175779158 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (4-methyl-3-pyridinyl) propanoate |
| SMILES | CCC(=O)Oc1cnccc1C |
| InChI | InChI=1S/C9H11NO2/c1-3-9(11)12-8-6-10-5-4-7(8)2/h4-6H,3H2,1-2H3 |
| InChIKey | OPFMRBRWCSTZNV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyl-3-pyridinyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-3-pyridinyl) propanoate?
The IUPAC name of (4-methyl-3-pyridinyl) propanoate (CID 175779158) is (4-methyl-3-pyridinyl) propanoate.
What is the SMILES notation for (4-methyl-3-pyridinyl) propanoate?
The canonical SMILES for (4-methyl-3-pyridinyl) propanoate is CCC(=O)Oc1cnccc1C.
What is the InChIKey of (4-methyl-3-pyridinyl) propanoate?
The InChIKey is OPFMRBRWCSTZNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-3-9(11)12-8-6-10-5-4-7(8)2/h4-6H,3H2,1-2H3.
What are the key properties of (4-methyl-3-pyridinyl) propanoate?
(4-methyl-3-pyridinyl) propanoate has a molecular weight of 165.19 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-3-pyridinyl) propanoate is sourced from PubChem (CID 175779158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).