C16H20N2O — CID 170865971
N,N-dimethyl-3-(4-pyridin-3-yloxyphenyl)propan-1-amine (PubChem CID 170865971) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-pyridin-3-yloxyphenyl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(4-pyridin-3-yloxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 170865971 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N,N-dimethyl-3-(4-pyridin-3-yloxyphenyl)propan-1-amine |
| SMILES | CN(C)CCCc1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C16H20N2O/c1-18(2)12-4-5-14-7-9-15(10-8-14)19-16-6-3-11-17-13-16/h3,6-11,13H,4-5,12H2,1-2H3 |
| InChIKey | UQUIEIPMUPDKIH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |