C14H25NOSi — CID 170865655
N,N-dimethyl-3-(4-trimethylsilyloxyphenyl)propan-1-amine (PubChem CID 170865655) has the molecular formula C14H25NOSi and a molecular weight of 251.45 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-trimethylsilyloxyphenyl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(4-trimethylsilyloxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 170865655 |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N,N-dimethyl-3-(4-trimethylsilyloxyphenyl)propan-1-amine |
| SMILES | CN(C)CCCc1ccc(O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C14H25NOSi/c1-15(2)12-6-7-13-8-10-14(11-9-13)16-17(3,4)5/h8-11H,6-7,12H2,1-5H3 |
| InChIKey | UWRDSHGSMIWLFK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|